C11H22N2O — CID 103805727
N-[(1R,2R)-2-aminocyclohexyl]-2-methylbutanamide (PubChem CID 103805727) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-2-methylbutanamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 103805727 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C11H22N2O/c1-3-8(2)11(14)13-10-7-5-4-6-9(10)12/h8-10H,3-7,12H2,1-2H3,(H,13,14)/t8?,9-,10-/m1/s1 |
| InChIKey | OCCAYEUVESZVQE-VXRWAFEHSA-N |
| XLogP | 1.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |