C20H23NS — CID 10380647
1'-benzylspiro[3,4-dihydrothiochromene-2,4'-piperidine] (PubChem CID 10380647) has the molecular formula C20H23NS and a molecular weight of 309.48 g/mol. Its IUPAC name is 1'-benzylspiro[3,4-dihydrothiochromene-2,4'-piperidine].
| Compound Name | 1'-benzylspiro[3,4-dihydrothiochromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 10380647 |
| Molecular Formula | C20H23NS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1'-benzylspiro[3,4-dihydrothiochromene-2,4'-piperidine] |
| SMILES | c1ccc(CN2CCC3(CCc4ccccc4S3)CC2)cc1 |
| InChI | InChI=1S/C20H23NS/c1-2-6-17(7-3-1)16-21-14-12-20(13-15-21)11-10-18-8-4-5-9-19(18)22-20/h1-9H,10-16H2 |
| InChIKey | FPSFVONLLBIZFK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |