C12H16Cl2N2OS — CID 103806544
2,5-dichloro-N-propyl-N-pyrrolidin-3-ylthiophene-3-carboxamide (PubChem CID 103806544) has the molecular formula C12H16Cl2N2OS and a molecular weight of 307.25 g/mol. Its IUPAC name is 2,5-dichloro-N-propyl-N-pyrrolidin-3-ylthiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-propyl-N-pyrrolidin-3-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 103806544 |
| Molecular Formula | C12H16Cl2N2OS |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2,5-dichloro-N-propyl-N-pyrrolidin-3-ylthiophene-3-carboxamide |
| SMILES | CCCN(C(=O)c1cc(Cl)sc1Cl)C1CCNC1 |
| InChI | InChI=1S/C12H16Cl2N2OS/c1-2-5-16(8-3-4-15-7-8)12(17)9-6-10(13)18-11(9)14/h6,8,15H,2-5,7H2,1H3 |
| InChIKey | LYIOFAWCLSVUMD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |