C9H14F4N2O — CID 103806938
N-(1-amino-2-cyclopropylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103806938) has the molecular formula C9H14F4N2O and a molecular weight of 242.22 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103806938 |
| Molecular Formula | C9H14F4N2O |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(CN)(NC(=O)C(F)(F)C(F)F)C1CC1 |
| InChI | InChI=1S/C9H14F4N2O/c1-8(4-14,5-2-3-5)15-7(16)9(12,13)6(10)11/h5-6H,2-4,14H2,1H3,(H,15,16) |
| InChIKey | MJAUFDYAYILJFY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|