C12H18F4N2O — CID 103807420
1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 103807420) has the molecular formula C12H18F4N2O and a molecular weight of 282.28 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 103807420 |
| Molecular Formula | C12H18F4N2O |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | O=C(N1CCC(NCC2CC2)CC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H18F4N2O/c13-10(14)12(15,16)11(19)18-5-3-9(4-6-18)17-7-8-1-2-8/h8-10,17H,1-7H2 |
| InChIKey | RQWNCXBQWAYYCV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|