C17H26N2O2 — CID 103808128
1-amino-N-[2-(2-methoxyphenyl)ethyl]-3-methylcyclohexane-1-carboxamide (PubChem CID 103808128) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-amino-N-[2-(2-methoxyphenyl)ethyl]-3-methylcyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-[2-(2-methoxyphenyl)ethyl]-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 103808128 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-amino-N-[2-(2-methoxyphenyl)ethyl]-3-methylcyclohexane-1-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)C1(N)CCCC(C)C1 |
| InChI | InChI=1S/C17H26N2O2/c1-13-6-5-10-17(18,12-13)16(20)19-11-9-14-7-3-4-8-15(14)21-2/h3-4,7-8,13H,5-6,9-12,18H2,1-2H3,(H,19,20) |
| InChIKey | SYLBYLDGKFEZOA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |