C16H22N2O3 — CID 103808191
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylpiperidine-2-carboxamide (PubChem CID 103808191) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylpiperidine-2-carboxamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 103808191 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylpiperidine-2-carboxamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C16H22N2O3/c1-2-18(16(19)13-5-3-4-8-17-13)10-12-6-7-14-15(9-12)21-11-20-14/h6-7,9,13,17H,2-5,8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | YSBUUXMCQAYNED-ZDUSSCGKSA-N |
| XLogP | 1.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |