C10H12FN3O2 — CID 103808720
N-(6-fluoro-3-pyridinyl)morpholine-2-carboxamide (PubChem CID 103808720) has the molecular formula C10H12FN3O2 and a molecular weight of 225.22 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)morpholine-2-carboxamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 103808720 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)morpholine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)nc1)C1CNCCO1 |
| InChI | InChI=1S/C10H12FN3O2/c11-9-2-1-7(5-13-9)14-10(15)8-6-12-3-4-16-8/h1-2,5,8,12H,3-4,6H2,(H,14,15) |
| InChIKey | RRKJZKSGERHTNK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|