C10H18F3N3OS — CID 103809155
2-(4-aminopiperidin-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide (PubChem CID 103809155) has the molecular formula C10H18F3N3OS and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 103809155 |
| Molecular Formula | C10H18F3N3OS |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide |
| SMILES | NC1CCN(CC(=O)NCCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3N3OS/c11-10(12,13)18-6-3-15-9(17)7-16-4-1-8(14)2-5-16/h8H,1-7,14H2,(H,15,17) |
| InChIKey | JUZZBGARYUABQJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|