C15H26O5Si — CID 10380941
6-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 10380941) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is 6-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10380941 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C([C@@H]2O[C@@H]2CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H26O5Si/c1-14(2,3)21(6,7)17-9-11-13(18-11)10-8-12(16)20-15(4,5)19-10/h8,11,13H,9H2,1-7H3/t11-,13+/m1/s1 |
| InChIKey | GLOUDNUEZQLCOV-YPMHNXCESA-N |
| XLogP | 2.97 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|