C19H25NOS — CID 10381008
3-[(3R,4R)-3,4-dimethyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]phenol (PubChem CID 10381008) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 3-[(3R,4R)-3,4-dimethyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4R)-3,4-dimethyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 10381008 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 3-[(3R,4R)-3,4-dimethyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]phenol |
| SMILES | C[C@H]1CN(CCc2cccs2)CC[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C19H25NOS/c1-15-14-20(10-8-18-7-4-12-22-18)11-9-19(15,2)16-5-3-6-17(21)13-16/h3-7,12-13,15,21H,8-11,14H2,1-2H3/t15-,19+/m0/s1 |
| InChIKey | DGEXSDIRTDWGOA-HNAYVOBHSA-N |
| XLogP | 4.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |