C20H15NO3 — CID 10381114
1,8-dihydroxy-10-(pyridin-4-ylmethyl)-10H-anthracen-9-one (PubChem CID 10381114) has the molecular formula C20H15NO3 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1,8-dihydroxy-10-(pyridin-4-ylmethyl)-10H-anthracen-9-one.
| Compound Name | 1,8-dihydroxy-10-(pyridin-4-ylmethyl)-10H-anthracen-9-one |
|---|---|
| PubChem CID | 10381114 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1,8-dihydroxy-10-(pyridin-4-ylmethyl)-10H-anthracen-9-one |
| SMILES | O=C1c2c(O)cccc2C(Cc2ccncc2)c2cccc(O)c21 |
| InChI | InChI=1S/C20H15NO3/c22-16-5-1-3-13-15(11-12-7-9-21-10-8-12)14-4-2-6-17(23)19(14)20(24)18(13)16/h1-10,15,22-23H,11H2 |
| InChIKey | CJUOVDQUHOAHEH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |