About (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone
(4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 103811859) has the molecular formula C12H16N2O3S
and a molecular weight of 268.34 g/mol. Its IUPAC name is (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone.
Molecular Properties
| Compound Name | (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| PubChem CID | 103811859 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H16N2O3S/c1-9-8-18(16,17)7-6-14(9)12(15)10-2-4-11(13)5-3-10/h2-5,9H,6-8,13H2,1H3 |
| InChIKey | VTPVGNOBAROSMI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The IUPAC name of (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone (CID 103811859) is (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone.
What is the SMILES notation for (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The canonical SMILES for (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone is CC1CS(=O)(=O)CCN1C(=O)c1ccc(N)cc1.
What is the InChIKey of (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The InChIKey is VTPVGNOBAROSMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S/c1-9-8-18(16,17)7-6-14(9)12(15)10-2-4-11(13)5-3-10/h2-5,9H,6-8,13H2,1H3.
What are the key properties of (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone?
(4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone has a molecular weight of 268.34 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone is sourced from PubChem (CID 103811859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).