C18H22O3S — CID 10381222
4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-4-phenylsulfanylbutanal (PubChem CID 10381222) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-4-phenylsulfanylbutanal.
| Compound Name | 4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-4-phenylsulfanylbutanal |
|---|---|
| PubChem CID | 10381222 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-4-phenylsulfanylbutanal |
| SMILES | CC1(C)CC(=O)C(C(CCC=O)Sc2ccccc2)=C(O)C1 |
| InChI | InChI=1S/C18H22O3S/c1-18(2)11-14(20)17(15(21)12-18)16(9-6-10-19)22-13-7-4-3-5-8-13/h3-5,7-8,10,16,20H,6,9,11-12H2,1-2H3 |
| InChIKey | FLJOJTDTQDNLQM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|