C16H26N2OS — CID 103812535
3-amino-N-(2-ethyl-2-methylsulfanylbutyl)-2-phenylpropanamide (PubChem CID 103812535) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is 3-amino-N-(2-ethyl-2-methylsulfanylbutyl)-2-phenylpropanamide.
| Compound Name | 3-amino-N-(2-ethyl-2-methylsulfanylbutyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 103812535 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-amino-N-(2-ethyl-2-methylsulfanylbutyl)-2-phenylpropanamide |
| SMILES | CCC(CC)(CNC(=O)C(CN)c1ccccc1)SC |
| InChI | InChI=1S/C16H26N2OS/c1-4-16(5-2,20-3)12-18-15(19)14(11-17)13-9-7-6-8-10-13/h6-10,14H,4-5,11-12,17H2,1-3H3,(H,18,19) |
| InChIKey | VTIAUJARQOCLCF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |