C18H24O3S — CID 10381359
[(E,3S)-2,2,6-trimethyl-1-oxo-7-phenylsulfanylhept-5-en-3-yl] acetate (PubChem CID 10381359) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is [(E,3S)-2,2,6-trimethyl-1-oxo-7-phenylsulfanylhept-5-en-3-yl] acetate.
| Compound Name | [(E,3S)-2,2,6-trimethyl-1-oxo-7-phenylsulfanylhept-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 10381359 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(E,3S)-2,2,6-trimethyl-1-oxo-7-phenylsulfanylhept-5-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](C/C=C(\C)CSc1ccccc1)C(C)(C)C=O |
| InChI | InChI=1S/C18H24O3S/c1-14(12-22-16-8-6-5-7-9-16)10-11-17(21-15(2)20)18(3,4)13-19/h5-10,13,17H,11-12H2,1-4H3/b14-10+/t17-/m0/s1 |
| InChIKey | ZDOVFNMMGYAVEC-SHRNQRGKSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|