C10H19N3O — CID 103814042
1-amino-N-[(1-methylpyrrolidin-2-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 103814042) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-amino-N-[(1-methylpyrrolidin-2-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-[(1-methylpyrrolidin-2-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103814042 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-amino-N-[(1-methylpyrrolidin-2-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | CN1CCCC1CNC(=O)C1(N)CC1 |
| InChI | InChI=1S/C10H19N3O/c1-13-6-2-3-8(13)7-12-9(14)10(11)4-5-10/h8H,2-7,11H2,1H3,(H,12,14) |
| InChIKey | ISXHOPKYBCMWBG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |