C10H21N3O — CID 103814330
(2S)-2-amino-N-[2-[cyclopropyl(ethyl)amino]ethyl]propanamide (PubChem CID 103814330) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[cyclopropyl(ethyl)amino]ethyl]propanamide.
| Compound Name | (2S)-2-amino-N-[2-[cyclopropyl(ethyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 103814330 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (2S)-2-amino-N-[2-[cyclopropyl(ethyl)amino]ethyl]propanamide |
| SMILES | CCN(CCNC(=O)[C@H](C)N)C1CC1 |
| InChI | InChI=1S/C10H21N3O/c1-3-13(9-4-5-9)7-6-12-10(14)8(2)11/h8-9H,3-7,11H2,1-2H3,(H,12,14)/t8-/m0/s1 |
| InChIKey | ZCPRVEZRTMNZND-QMMMGPOBSA-N |
| XLogP | -0.07 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |