C14H24N4O — CID 103814722
2-methyl-N-[(1-methylpyrrol-3-yl)methyl]-2-piperazin-1-ylpropanamide (PubChem CID 103814722) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-methyl-N-[(1-methylpyrrol-3-yl)methyl]-2-piperazin-1-ylpropanamide.
| Compound Name | 2-methyl-N-[(1-methylpyrrol-3-yl)methyl]-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 103814722 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 2-methyl-N-[(1-methylpyrrol-3-yl)methyl]-2-piperazin-1-ylpropanamide |
| SMILES | Cn1ccc(CNC(=O)C(C)(C)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H24N4O/c1-14(2,18-8-5-15-6-9-18)13(19)16-10-12-4-7-17(3)11-12/h4,7,11,15H,5-6,8-10H2,1-3H3,(H,16,19) |
| InChIKey | GCNZRZGSYNLIHF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |