About (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine
(1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine (PubChem CID 103816158) has the molecular formula C13H25NOS
and a molecular weight of 243.42 g/mol. Its IUPAC name is (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine.
Molecular Properties
| Compound Name | (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine |
| PubChem CID | 103816158 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine |
| SMILES | CS(=O)CCNC1[C@@H]2CCCC[C@@H]2C1(C)C |
| InChI | InChI=1S/C13H25NOS/c1-13(2)11-7-5-4-6-10(11)12(13)14-8-9-16(3)15/h10-12,14H,4-9H2,1-3H3/t10-,11+,12?,16?/m1/s1 |
| InChIKey | BPQLRZCMCPMELQ-GUVYTERUSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine?
The IUPAC name of (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine (CID 103816158) is (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine.
What is the SMILES notation for (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine?
The canonical SMILES for (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine is CS(=O)CCNC1[C@@H]2CCCC[C@@H]2C1(C)C.
What is the InChIKey of (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine?
The InChIKey is BPQLRZCMCPMELQ-GUVYTERUSA-N. The full InChI is InChI=1S/C13H25NOS/c1-13(2)11-7-5-4-6-10(11)12(13)14-8-9-16(3)15/h10-12,14H,4-9H2,1-3H3/t10-,11+,12?,16?/m1/s1.
What are the key properties of (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine?
(1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine has a molecular weight of 243.42 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-8,8-dimethyl-N-(2-methylsulfinylethyl)bicyclo[4.2.0]octan-7-amine is sourced from PubChem (CID 103816158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).