C18H25N3 — CID 103816376
N-[(1-cyclopentylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)methanamine (PubChem CID 103816376) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)methanamine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)methanamine |
|---|---|
| PubChem CID | 103816376 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-1-(4-ethylphenyl)methanamine |
| SMILES | CCc1ccc(CNCc2ccn(C3CCCC3)n2)cc1 |
| InChI | InChI=1S/C18H25N3/c1-2-15-7-9-16(10-8-15)13-19-14-17-11-12-21(20-17)18-5-3-4-6-18/h7-12,18-19H,2-6,13-14H2,1H3 |
| InChIKey | ZWXVADUGQYODHQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |