About 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol
1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol (PubChem CID 10381919) has the molecular formula C20H24FNO2
and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol |
| PubChem CID | 10381919 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol |
| SMILES | C[C@@H]([C@@H](O)c1ccc(F)cc1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24FNO2/c1-15(19(23)16-7-9-18(21)10-8-16)22-13-11-20(24,12-14-22)17-5-3-2-4-6-17/h2-10,15,19,23-24H,11-14H2,1H3/t15-,19+/m0/s1 |
| InChIKey | OURAJRTXVWZEMA-HNAYVOBHSA-N |
| XLogP | 3.23 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
The IUPAC name of 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol (CID 10381919) is 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol.
What is the SMILES notation for 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
The canonical SMILES for 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol is C[C@@H]([C@@H](O)c1ccc(F)cc1)N1CCC(O)(c2ccccc2)CC1.
What is the InChIKey of 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
The InChIKey is OURAJRTXVWZEMA-HNAYVOBHSA-N. The full InChI is InChI=1S/C20H24FNO2/c1-15(19(23)16-7-9-18(21)10-8-16)22-13-11-20(24,12-14-22)17-5-3-2-4-6-17/h2-10,15,19,23-24H,11-14H2,1H3/t15-,19+/m0/s1.
What are the key properties of 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol has a molecular weight of 329.42 g/mol, XLogP of 3.23, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol is sourced from PubChem (CID 10381919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).