About 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole
2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole (PubChem CID 10381921) has the molecular formula C18H19NO3S
and a molecular weight of 329.42 g/mol. Its IUPAC name is 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole.
Molecular Properties
| Compound Name | 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole |
| PubChem CID | 10381921 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole |
| SMILES | CC1C(c2ccccc2)=C(c2ccc(S(C)(=O)=O)cc2)ON1C |
| InChI | InChI=1S/C18H19NO3S/c1-13-17(14-7-5-4-6-8-14)18(22-19(13)2)15-9-11-16(12-10-15)23(3,20)21/h4-13H,1-3H3 |
| InChIKey | WHDGULRDPVFQTJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole?
The IUPAC name of 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole (CID 10381921) is 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole.
What is the SMILES notation for 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole?
The canonical SMILES for 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole is CC1C(c2ccccc2)=C(c2ccc(S(C)(=O)=O)cc2)ON1C.
What is the InChIKey of 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole?
The InChIKey is WHDGULRDPVFQTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3S/c1-13-17(14-7-5-4-6-8-14)18(22-19(13)2)15-9-11-16(12-10-15)23(3,20)21/h4-13H,1-3H3.
What are the key properties of 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole?
2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole has a molecular weight of 329.42 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5-(4-methylsulfonylphenyl)-4-phenyl-3H-1,2-oxazole is sourced from PubChem (CID 10381921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).