C13H15N3O3 — CID 103819854
N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(4-cyanophenyl)acetamide (PubChem CID 103819854) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(4-cyanophenyl)acetamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 103819854 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(CC(=O)NCCOCC(N)=O)cc1 |
| InChI | InChI=1S/C13H15N3O3/c14-8-11-3-1-10(2-4-11)7-13(18)16-5-6-19-9-12(15)17/h1-4H,5-7,9H2,(H2,15,17)(H,16,18) |
| InChIKey | AOVZIEKQCAUARS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|