C16H22O5S — CID 10381990
ethyl 3,3,5,5-tetradeuterio-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate (PubChem CID 10381990) has the molecular formula C16H22O5S and a molecular weight of 330.44 g/mol. Its IUPAC name is ethyl 3,3,5,5-tetradeuterio-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate.
| Compound Name | ethyl 3,3,5,5-tetradeuterio-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10381990 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl 3,3,5,5-tetradeuterio-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
| SMILES | [2H]C1([2H])CC(C(=O)OCC)CC([2H])([2H])C1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O5S/c1-3-20-16(17)13-6-8-14(9-7-13)21-22(18,19)15-10-4-12(2)5-11-15/h4-5,10-11,13-14H,3,6-9H2,1-2H3/i8D2,9D2 |
| InChIKey | AHJHOPFLUQMYHC-LZMSFWOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|