C12H25NO3S — CID 103820089
2-[1-(3,3-dimethylbutylsulfonyl)pyrrolidin-3-yl]ethanol (PubChem CID 103820089) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is 2-[1-(3,3-dimethylbutylsulfonyl)pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[1-(3,3-dimethylbutylsulfonyl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 103820089 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-[1-(3,3-dimethylbutylsulfonyl)pyrrolidin-3-yl]ethanol |
| SMILES | CC(C)(C)CCS(=O)(=O)N1CCC(CCO)C1 |
| InChI | InChI=1S/C12H25NO3S/c1-12(2,3)6-9-17(15,16)13-7-4-11(10-13)5-8-14/h11,14H,4-10H2,1-3H3 |
| InChIKey | WTVKQQTYGWPVDO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |