About [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene
[(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene (PubChem CID 10382031) has the molecular formula C17H17NO4S
and a molecular weight of 331.39 g/mol. Its IUPAC name is [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene.
Molecular Properties
| Compound Name | [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene |
| PubChem CID | 10382031 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene |
| SMILES | COCO[C@H](/C=C(\Sc1ccccc1)[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H17NO4S/c1-21-13-22-16(14-8-4-2-5-9-14)12-17(18(19)20)23-15-10-6-3-7-11-15/h2-12,16H,13H2,1H3/b17-12-/t16-/m1/s1 |
| InChIKey | PZRAFONVUBFGGR-WISAJEAXSA-N |
| XLogP | 4.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene?
The IUPAC name of [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene (CID 10382031) is [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene.
What is the SMILES notation for [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene?
The canonical SMILES for [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene is COCO[C@H](/C=C(\Sc1ccccc1)[N+](=O)[O-])c1ccccc1.
What is the InChIKey of [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene?
The InChIKey is PZRAFONVUBFGGR-WISAJEAXSA-N. The full InChI is InChI=1S/C17H17NO4S/c1-21-13-22-16(14-8-4-2-5-9-14)12-17(18(19)20)23-15-10-6-3-7-11-15/h2-12,16H,13H2,1H3/b17-12-/t16-/m1/s1.
What are the key properties of [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene?
[(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene has a molecular weight of 331.39 g/mol, XLogP of 4.26, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,1R)-1-(methoxymethoxy)-3-nitro-3-phenylsulfanylprop-2-enyl]benzene is sourced from PubChem (CID 10382031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).