C19H25NO4 — CID 10382035
2-ethyl-10-hydroxy-8-pentoxy-1,2,3,4-tetrahydrochromeno[4,3-b]pyridin-5-one (PubChem CID 10382035) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-ethyl-10-hydroxy-8-pentoxy-1,2,3,4-tetrahydrochromeno[4,3-b]pyridin-5-one.
| Compound Name | 2-ethyl-10-hydroxy-8-pentoxy-1,2,3,4-tetrahydrochromeno[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 10382035 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-ethyl-10-hydroxy-8-pentoxy-1,2,3,4-tetrahydrochromeno[4,3-b]pyridin-5-one |
| SMILES | CCCCCOc1cc(O)c2c3c(c(=O)oc2c1)CCC(CC)N3 |
| InChI | InChI=1S/C19H25NO4/c1-3-5-6-9-23-13-10-15(21)17-16(11-13)24-19(22)14-8-7-12(4-2)20-18(14)17/h10-12,20-21H,3-9H2,1-2H3 |
| InChIKey | COEVCGYKPQEJBJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|