About 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one
8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 10382057) has the molecular formula C17H14ClNO2S
and a molecular weight of 331.82 g/mol. Its IUPAC name is 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one |
| PubChem CID | 10382057 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | O=C(CN1C(=O)CCSc2cc(Cl)ccc21)c1ccccc1 |
| InChI | InChI=1S/C17H14ClNO2S/c18-13-6-7-14-16(10-13)22-9-8-17(21)19(14)11-15(20)12-4-2-1-3-5-12/h1-7,10H,8-9,11H2 |
| InChIKey | SZQWVNHKQHVVER-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one?
The IUPAC name of 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one (CID 10382057) is 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one.
What is the SMILES notation for 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one?
The canonical SMILES for 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one is O=C(CN1C(=O)CCSc2cc(Cl)ccc21)c1ccccc1.
What is the InChIKey of 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one?
The InChIKey is SZQWVNHKQHVVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO2S/c18-13-6-7-14-16(10-13)22-9-8-17(21)19(14)11-15(20)12-4-2-1-3-5-12/h1-7,10H,8-9,11H2.
What are the key properties of 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one?
8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one has a molecular weight of 331.82 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-phenacyl-2,3-dihydro-1,5-benzothiazepin-4-one is sourced from PubChem (CID 10382057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).