C12H17NO2 — CID 103820772
N-[(2S)-1-hydroxypropan-2-yl]-2,6-dimethylbenzamide (PubChem CID 103820772) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-[(2S)-1-hydroxypropan-2-yl]-2,6-dimethylbenzamide.
| Compound Name | N-[(2S)-1-hydroxypropan-2-yl]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 103820772 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-[(2S)-1-hydroxypropan-2-yl]-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C12H17NO2/c1-8-5-4-6-9(2)11(8)12(15)13-10(3)7-14/h4-6,10,14H,7H2,1-3H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | QEHRLHJGRKJCRW-JTQLQIEISA-N |
| XLogP | 1.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |