C18H36N2O2 — CID 103821958
tert-butyl N-[3-[[1-(2-methylpropyl)cyclopentyl]methylamino]propyl]carbamate (PubChem CID 103821958) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-(2-methylpropyl)cyclopentyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-(2-methylpropyl)cyclopentyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103821958 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | tert-butyl N-[3-[[1-(2-methylpropyl)cyclopentyl]methylamino]propyl]carbamate |
| SMILES | CC(C)CC1(CNCCCNC(=O)OC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C18H36N2O2/c1-15(2)13-18(9-6-7-10-18)14-19-11-8-12-20-16(21)22-17(3,4)5/h15,19H,6-14H2,1-5H3,(H,20,21) |
| InChIKey | IHPGDQURBILPPX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|