C13H12N4O3 — CID 103822655
N-(2,6-dioxopiperidin-3-yl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 103822655) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103822655 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cnn3ccccc23)C(=O)N1 |
| InChI | InChI=1S/C13H12N4O3/c18-11-5-4-9(13(20)16-11)15-12(19)8-7-14-17-6-2-1-3-10(8)17/h1-3,6-7,9H,4-5H2,(H,15,19)(H,16,18,20) |
| InChIKey | UQMJMLWYPCOZDO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|