About 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide
3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide (PubChem CID 103822793) has the molecular formula C10H22N4O
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide |
| PubChem CID | 103822793 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide |
| SMILES | CCCN/C(N)=N/CC(C)(C)C(=O)NC |
| InChI | InChI=1S/C10H22N4O/c1-5-6-13-9(11)14-7-10(2,3)8(15)12-4/h5-7H2,1-4H3,(H,12,15)(H3,11,13,14) |
| InChIKey | USQRYNAUMWDUDW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide?
The IUPAC name of 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide (CID 103822793) is 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide.
What is the SMILES notation for 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide?
The canonical SMILES for 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide is CCCN/C(N)=N/CC(C)(C)C(=O)NC.
What is the InChIKey of 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide?
The InChIKey is USQRYNAUMWDUDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O/c1-5-6-13-9(11)14-7-10(2,3)8(15)12-4/h5-7H2,1-4H3,(H,12,15)(H3,11,13,14).
What are the key properties of 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide?
3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide has a molecular weight of 214.31 g/mol, XLogP of 0.07, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[amino(propylamino)methylidene]amino]-N,2,2-trimethylpropanamide is sourced from PubChem (CID 103822793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).