About 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol
3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol (PubChem CID 103823079) has the molecular formula C12H22N2O2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol |
| PubChem CID | 103823079 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)NC(C)c1nc(C)sc1C |
| InChI | InChI=1S/C12H22N2O2S/c1-8(12-9(2)17-10(3)14-12)13-11(5-6-15)7-16-4/h8,11,13,15H,5-7H2,1-4H3 |
| InChIKey | QRXBMEBZPVZSPK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol?
The IUPAC name of 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol (CID 103823079) is 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol.
What is the SMILES notation for 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol?
The canonical SMILES for 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol is COCC(CCO)NC(C)c1nc(C)sc1C.
What is the InChIKey of 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol?
The InChIKey is QRXBMEBZPVZSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2S/c1-8(12-9(2)17-10(3)14-12)13-11(5-6-15)7-16-4/h8,11,13,15H,5-7H2,1-4H3.
What are the key properties of 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol?
3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol has a molecular weight of 258.39 g/mol, XLogP of 1.81, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-4-methoxybutan-1-ol is sourced from PubChem (CID 103823079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).