C13H18N4O4 — CID 103823299
4-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]-3-nitrobenzamide (PubChem CID 103823299) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]-3-nitrobenzamide.
| Compound Name | 4-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 103823299 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]-3-nitrobenzamide |
| SMILES | CNC(=O)C(C)(C)CNc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N4O4/c1-13(2,12(19)15-3)7-16-9-5-4-8(11(14)18)6-10(9)17(20)21/h4-6,16H,7H2,1-3H3,(H2,14,18)(H,15,19) |
| InChIKey | VKLAFSXOXIYTNG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|