C11H16N4O3 — CID 103823304
N,2,2-trimethyl-3-[(2-nitro-3-pyridinyl)amino]propanamide (PubChem CID 103823304) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is N,2,2-trimethyl-3-[(2-nitro-3-pyridinyl)amino]propanamide.
| Compound Name | N,2,2-trimethyl-3-[(2-nitro-3-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 103823304 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N,2,2-trimethyl-3-[(2-nitro-3-pyridinyl)amino]propanamide |
| SMILES | CNC(=O)C(C)(C)CNc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N4O3/c1-11(2,10(16)12-3)7-14-8-5-4-6-13-9(8)15(17)18/h4-6,14H,7H2,1-3H3,(H,12,16) |
| InChIKey | VIOHGVMUOUTBKH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|