C19H20N2 — CID 103823450
1-(4-ethylphenyl)-N-(isoquinolin-4-ylmethyl)methanamine (PubChem CID 103823450) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-N-(isoquinolin-4-ylmethyl)methanamine.
| Compound Name | 1-(4-ethylphenyl)-N-(isoquinolin-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 103823450 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-(4-ethylphenyl)-N-(isoquinolin-4-ylmethyl)methanamine |
| SMILES | CCc1ccc(CNCc2cncc3ccccc23)cc1 |
| InChI | InChI=1S/C19H20N2/c1-2-15-7-9-16(10-8-15)11-20-13-18-14-21-12-17-5-3-4-6-19(17)18/h3-10,12,14,20H,2,11,13H2,1H3 |
| InChIKey | MJKHFROPOSPKQG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |