C10H9ClN4O4 — CID 103824174
3-[(3-chloro-5-nitro-2-pyridinyl)amino]piperidine-2,6-dione (PubChem CID 103824174) has the molecular formula C10H9ClN4O4 and a molecular weight of 284.66 g/mol. Its IUPAC name is 3-[(3-chloro-5-nitro-2-pyridinyl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(3-chloro-5-nitro-2-pyridinyl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 103824174 |
| Molecular Formula | C10H9ClN4O4 |
| Molecular Weight | 284.66 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 3-[(3-chloro-5-nitro-2-pyridinyl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ncc([N+](=O)[O-])cc2Cl)C(=O)N1 |
| InChI | InChI=1S/C10H9ClN4O4/c11-6-3-5(15(18)19)4-12-9(6)13-7-1-2-8(16)14-10(7)17/h3-4,7H,1-2H2,(H,12,13)(H,14,16,17) |
| InChIKey | QPXPLDHIDBBJCD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.66 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|