C11H16FN3O — CID 103826213
5-fluoro-N-[1-(oxan-4-yl)ethyl]pyrimidin-2-amine (PubChem CID 103826213) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is 5-fluoro-N-[1-(oxan-4-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[1-(oxan-4-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103826213 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-fluoro-N-[1-(oxan-4-yl)ethyl]pyrimidin-2-amine |
| SMILES | CC(Nc1ncc(F)cn1)C1CCOCC1 |
| InChI | InChI=1S/C11H16FN3O/c1-8(9-2-4-16-5-3-9)15-11-13-6-10(12)7-14-11/h6-9H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | ZYOMDYMHLJLNGI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |