C19H34O5 — CID 10382771
(E)-3-[(4S,5S)-5-[(10R)-10-hydroxyundecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid (PubChem CID 10382771) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is (E)-3-[(4S,5S)-5-[(10R)-10-hydroxyundecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(4S,5S)-5-[(10R)-10-hydroxyundecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10382771 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (E)-3-[(4S,5S)-5-[(10R)-10-hydroxyundecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid |
| SMILES | C[C@@H](O)CCCCCCCCC[C@@H]1OC(C)(C)O[C@H]1/C=C/C(=O)O |
| InChI | InChI=1S/C19H34O5/c1-15(20)11-9-7-5-4-6-8-10-12-16-17(13-14-18(21)22)24-19(2,3)23-16/h13-17,20H,4-12H2,1-3H3,(H,21,22)/b14-13+/t15-,16+,17+/m1/s1 |
| InChIKey | CGMWCCKAHBWVLJ-ACWVRRSXSA-N |
| XLogP | 4.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|