About 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one
4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one (PubChem CID 10382852) has the molecular formula C17H33NO4Si
and a molecular weight of 343.54 g/mol. Its IUPAC name is 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 10382852 |
| Molecular Formula | C17H33NO4Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCC[C@@H](C(=O)N1C(=O)OCC1C(C)C)[C@@H](CC)O[Si](C)(C)C |
| InChI | InChI=1S/C17H33NO4Si/c1-8-10-13(15(9-2)22-23(5,6)7)16(19)18-14(12(3)4)11-21-17(18)20/h12-15H,8-11H2,1-7H3/t13-,14?,15-/m1/s1 |
| InChIKey | AXOQETFVAPFWFC-GIJJTGMTSA-N |
| XLogP | 4.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one?
The IUPAC name of 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one (CID 10382852) is 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one is CCC[C@@H](C(=O)N1C(=O)OCC1C(C)C)[C@@H](CC)O[Si](C)(C)C.
What is the InChIKey of 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one?
The InChIKey is AXOQETFVAPFWFC-GIJJTGMTSA-N. The full InChI is InChI=1S/C17H33NO4Si/c1-8-10-13(15(9-2)22-23(5,6)7)16(19)18-14(12(3)4)11-21-17(18)20/h12-15H,8-11H2,1-7H3/t13-,14?,15-/m1/s1.
What are the key properties of 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one?
4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one has a molecular weight of 343.54 g/mol, XLogP of 4.04, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-3-[(2R,3R)-2-propyl-3-trimethylsilyloxypentanoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 10382852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).