C15H29NOS — CID 103829311
3-[2-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethylsulfanyl]propan-1-ol (PubChem CID 103829311) has the molecular formula C15H29NOS and a molecular weight of 271.47 g/mol. Its IUPAC name is 3-[2-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 103829311 |
| Molecular Formula | C15H29NOS |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 3-[2-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethylsulfanyl]propan-1-ol |
| SMILES | CC1(C)C(NCCSCCCO)[C@]2(C)CC[C@H]1C2 |
| InChI | InChI=1S/C15H29NOS/c1-14(2)12-5-6-15(3,11-12)13(14)16-7-10-18-9-4-8-17/h12-13,16-17H,4-11H2,1-3H3/t12-,13?,15+/m0/s1 |
| InChIKey | OWWSXTDOWFQBTJ-RMTCENKZSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|