C15H14BrNO3 — CID 103830352
4-bromo-3-hydroxy-N-[(2-methoxyphenyl)methyl]benzamide (PubChem CID 103830352) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 4-bromo-3-hydroxy-N-[(2-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-bromo-3-hydroxy-N-[(2-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 103830352 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 4-bromo-3-hydroxy-N-[(2-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccccc1CNC(=O)c1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C15H14BrNO3/c1-20-14-5-3-2-4-11(14)9-17-15(19)10-6-7-12(16)13(18)8-10/h2-8,18H,9H2,1H3,(H,17,19) |
| InChIKey | FSCYIOVXLZFXOZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |