C14H11BrFNO2 — CID 103830502
4-bromo-N-[(3-fluorophenyl)methyl]-3-hydroxybenzamide (PubChem CID 103830502) has the molecular formula C14H11BrFNO2 and a molecular weight of 324.15 g/mol. Its IUPAC name is 4-bromo-N-[(3-fluorophenyl)methyl]-3-hydroxybenzamide.
| Compound Name | 4-bromo-N-[(3-fluorophenyl)methyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 103830502 |
| Molecular Formula | C14H11BrFNO2 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4-bromo-N-[(3-fluorophenyl)methyl]-3-hydroxybenzamide |
| SMILES | O=C(NCc1cccc(F)c1)c1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C14H11BrFNO2/c15-12-5-4-10(7-13(12)18)14(19)17-8-9-2-1-3-11(16)6-9/h1-7,18H,8H2,(H,17,19) |
| InChIKey | RNEFDRMSGPJXQH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |