C16H29N3O2S — CID 103830765
tert-butyl N-[3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]propyl]-N-methylcarbamate (PubChem CID 103830765) has the molecular formula C16H29N3O2S and a molecular weight of 327.49 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 103830765 |
| Molecular Formula | C16H29N3O2S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | tert-butyl N-[3-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]propyl]-N-methylcarbamate |
| SMILES | Cc1nc(C(C)NCCCN(C)C(=O)OC(C)(C)C)c(C)s1 |
| InChI | InChI=1S/C16H29N3O2S/c1-11(14-12(2)22-13(3)18-14)17-9-8-10-19(7)15(20)21-16(4,5)6/h11,17H,8-10H2,1-7H3 |
| InChIKey | YYMRCQXKTNTPFL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|