C13H8F4N2O3S — CID 10383098
2,3,5,6-tetrafluoro-N-(3-sulfamoylphenyl)benzamide (PubChem CID 10383098) has the molecular formula C13H8F4N2O3S and a molecular weight of 348.28 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 10383098 |
| Molecular Formula | C13H8F4N2O3S |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(3-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C13H8F4N2O3S/c14-8-5-9(15)12(17)10(11(8)16)13(20)19-6-2-1-3-7(4-6)23(18,21)22/h1-5H,(H,19,20)(H2,18,21,22) |
| InChIKey | VNJRKOFATHWJBJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|