About 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione
6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione (PubChem CID 10383101) has the molecular formula C18H12N4O4
and a molecular weight of 348.32 g/mol. Its IUPAC name is 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione.
Molecular Properties
| Compound Name | 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione |
| PubChem CID | 10383101 |
| Molecular Formula | C18H12N4O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc2[nH]1 |
| InChI | InChI=1S/C18H12N4O4/c23-11-5-1-3-9(7-11)13-14(10-4-2-6-12(24)8-10)20-16-15(19-13)17(25)22-18(26)21-16/h1-8,23-24H,(H2,20,21,22,25,26) |
| InChIKey | MCICQGDYMXZNFS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione?
The IUPAC name of 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione (CID 10383101) is 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione.
What is the SMILES notation for 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione?
The canonical SMILES for 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione is O=c1[nH]c(=O)c2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc2[nH]1.
What is the InChIKey of 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione?
The InChIKey is MCICQGDYMXZNFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4O4/c23-11-5-1-3-9(7-11)13-14(10-4-2-6-12(24)8-10)20-16-15(19-13)17(25)22-18(26)21-16/h1-8,23-24H,(H2,20,21,22,25,26).
What are the key properties of 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione?
6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione has a molecular weight of 348.32 g/mol, XLogP of 1.75, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(3-hydroxyphenyl)-1H-pteridine-2,4-dione is sourced from PubChem (CID 10383101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).