C15H19N3O2 — CID 103831428
(2S)-2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]hexanamide (PubChem CID 103831428) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]hexanamide.
| Compound Name | (2S)-2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 103831428 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2S)-2-amino-N-[4-(1,3-oxazol-5-yl)phenyl]hexanamide |
| SMILES | CCCC[C@H](N)C(=O)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-2-3-4-13(16)15(19)18-12-7-5-11(6-8-12)14-9-17-10-20-14/h5-10,13H,2-4,16H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | ZXJOMXQWPGEYRD-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |