C15H30O5P2 — CID 10383351
[(6E)-1-[hydroxy(methyl)phosphoryl]-7,11-dimethyldodeca-6,10-dienyl]phosphonic acid (PubChem CID 10383351) has the molecular formula C15H30O5P2 and a molecular weight of 352.35 g/mol. Its IUPAC name is [(6E)-1-[hydroxy(methyl)phosphoryl]-7,11-dimethyldodeca-6,10-dienyl]phosphonic acid.
| Compound Name | [(6E)-1-[hydroxy(methyl)phosphoryl]-7,11-dimethyldodeca-6,10-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10383351 |
| Molecular Formula | C15H30O5P2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [(6E)-1-[hydroxy(methyl)phosphoryl]-7,11-dimethyldodeca-6,10-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCCC(P(C)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C15H30O5P2/c1-13(2)9-8-11-14(3)10-6-5-7-12-15(21(4,16)17)22(18,19)20/h9-10,15H,5-8,11-12H2,1-4H3,(H,16,17)(H2,18,19,20)/b14-10+ |
| InChIKey | TXSAXNBTLJLALN-GXDHUFHOSA-N |
| XLogP | 4.64 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|