About 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole
2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole (PubChem CID 10383379) has the molecular formula C20H20N2O2S
and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole |
| PubChem CID | 10383379 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole |
| SMILES | c1ccc(-c2nc(SCC3OCCCO3)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-3-8-15(9-4-1)18-19(16-10-5-2-6-11-16)22-20(21-18)25-14-17-23-12-7-13-24-17/h1-6,8-11,17H,7,12-14H2,(H,21,22) |
| InChIKey | XETLPYVHMQTADL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole (CID 10383379) is 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole is c1ccc(-c2nc(SCC3OCCCO3)[nH]c2-c2ccccc2)cc1.
What is the InChIKey of 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
The InChIKey is XETLPYVHMQTADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2S/c1-3-8-15(9-4-1)18-19(16-10-5-2-6-11-16)22-20(21-18)25-14-17-23-12-7-13-24-17/h1-6,8-11,17H,7,12-14H2,(H,21,22).
What are the key properties of 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole has a molecular weight of 352.46 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxan-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 10383379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).